C18H37NO4Si — CID 102100736
(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N-methyldec-2-enamide (PubChem CID 102100736) has the molecular formula C18H37NO4Si and a molecular weight of 359.58 g/mol. Its IUPAC name is (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N-methyldec-2-enamide.
| Compound Name | (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N-methyldec-2-enamide |
|---|---|
| PubChem CID | 102100736 |
| Molecular Formula | C18H37NO4Si |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-N-methoxy-N-methyldec-2-enamide |
| SMILES | CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C18H37NO4Si/c1-9-10-11-12-16(23-24(7,8)18(2,3)4)15(20)13-14-17(21)19(5)22-6/h13-16,20H,9-12H2,1-8H3/b14-13+/t15-,16-/m1/s1 |
| InChIKey | FEXSOEWJOYLCJT-GHAJFHELSA-N |
| XLogP | 3.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|