C12H23NO4 — CID 134859320
(E,4R,5R)-4,5-dihydroxy-N-methoxy-N-methyldec-2-enamide (PubChem CID 134859320) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is (E,4R,5R)-4,5-dihydroxy-N-methoxy-N-methyldec-2-enamide.
| Compound Name | (E,4R,5R)-4,5-dihydroxy-N-methoxy-N-methyldec-2-enamide |
|---|---|
| PubChem CID | 134859320 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (E,4R,5R)-4,5-dihydroxy-N-methoxy-N-methyldec-2-enamide |
| SMILES | CCCCC[C@@H](O)[C@H](O)/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C12H23NO4/c1-4-5-6-7-10(14)11(15)8-9-12(16)13(2)17-3/h8-11,14-15H,4-7H2,1-3H3/b9-8+/t10-,11-/m1/s1 |
| InChIKey | AXMFGGFJHNWQSN-WUNNSPOASA-N |
| XLogP | 0.86 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|