C14H25NO3 — CID 24755027
(2Z,4E,11S)-11-hydroxy-N-methoxy-N-methyldodeca-2,4-dienamide (PubChem CID 24755027) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (2Z,4E,11S)-11-hydroxy-N-methoxy-N-methyldodeca-2,4-dienamide.
| Compound Name | (2Z,4E,11S)-11-hydroxy-N-methoxy-N-methyldodeca-2,4-dienamide |
|---|---|
| PubChem CID | 24755027 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (2Z,4E,11S)-11-hydroxy-N-methoxy-N-methyldodeca-2,4-dienamide |
| SMILES | CON(C)C(=O)/C=C\C=C\CCCCC[C@H](C)O |
| InChI | InChI=1S/C14H25NO3/c1-13(16)11-9-7-5-4-6-8-10-12-14(17)15(2)18-3/h6,8,10,12-13,16H,4-5,7,9,11H2,1-3H3/b8-6+,12-10-/t13-/m0/s1 |
| InChIKey | JPWJHKBGDZYKJR-UDQHIXNXSA-N |
| XLogP | 2.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|