C14H27NO3 — CID 46211276
(E,5R)-5-hydroxy-N-methoxy-N-methyldodec-2-enamide (PubChem CID 46211276) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (E,5R)-5-hydroxy-N-methoxy-N-methyldodec-2-enamide.
| Compound Name | (E,5R)-5-hydroxy-N-methoxy-N-methyldodec-2-enamide |
|---|---|
| PubChem CID | 46211276 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (E,5R)-5-hydroxy-N-methoxy-N-methyldodec-2-enamide |
| SMILES | CCCCCCC[C@@H](O)C/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C14H27NO3/c1-4-5-6-7-8-10-13(16)11-9-12-14(17)15(2)18-3/h9,12-13,16H,4-8,10-11H2,1-3H3/b12-9+/t13-/m1/s1 |
| InChIKey | RAHHMNKGUSSWMR-CNELAYHGSA-N |
| XLogP | 2.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|