C10H19NO4 — CID 134860903
(Z,4R,7R)-4,7-dihydroxy-N-methoxy-N-methyloct-2-enamide (PubChem CID 134860903) has the molecular formula C10H19NO4 and a molecular weight of 217.27 g/mol. Its IUPAC name is (Z,4R,7R)-4,7-dihydroxy-N-methoxy-N-methyloct-2-enamide.
| Compound Name | (Z,4R,7R)-4,7-dihydroxy-N-methoxy-N-methyloct-2-enamide |
|---|---|
| PubChem CID | 134860903 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (Z,4R,7R)-4,7-dihydroxy-N-methoxy-N-methyloct-2-enamide |
| SMILES | CON(C)C(=O)/C=C\[C@H](O)CC[C@@H](C)O |
| InChI | InChI=1S/C10H19NO4/c1-8(12)4-5-9(13)6-7-10(14)11(2)15-3/h6-9,12-13H,4-5H2,1-3H3/b7-6-/t8-,9-/m1/s1 |
| InChIKey | VXNNWNPRYMTAAP-IEKVDETDSA-N |
| XLogP | 0.08 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|