C10H18BrMgNO4 — CID 134860902
magnesium;(Z,4R,7R)-7-hydroxy-1-[methoxy(methyl)amino]-1-oxooct-2-en-4-olate;bromide (PubChem CID 134860902) has the molecular formula C10H18BrMgNO4 and a molecular weight of 320.47 g/mol. Its IUPAC name is magnesium;(Z,4R,7R)-7-hydroxy-1-[methoxy(methyl)amino]-1-oxooct-2-en-4-olate;bromide.
| Compound Name | magnesium;(Z,4R,7R)-7-hydroxy-1-[methoxy(methyl)amino]-1-oxooct-2-en-4-olate;bromide |
|---|---|
| PubChem CID | 134860902 |
| Molecular Formula | C10H18BrMgNO4 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | magnesium;(Z,4R,7R)-7-hydroxy-1-[methoxy(methyl)amino]-1-oxooct-2-en-4-olate;bromide |
| SMILES | CON(C)C(=O)/C=C\[C@H]([O-])CC[C@@H](C)O.[Br-].[Mg+2] |
| InChI | InChI=1S/C10H18NO4.BrH.Mg/c1-8(12)4-5-9(13)6-7-10(14)11(2)15-3;;/h6-9,12H,4-5H2,1-3H3;1H;/q-1;;+2/p-1/b7-6-;;/t8-,9-;;/m1../s1 |
| InChIKey | UORIAZMHFFQQKL-JCBIYBAHSA-M |
| XLogP | -3.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|