C33H34F3N3O3 — CID 10210273
1-benzoyl-N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide (PubChem CID 10210273) has the molecular formula C33H34F3N3O3 and a molecular weight of 577.65 g/mol. Its IUPAC name is 1-benzoyl-N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 10210273 |
| Molecular Formula | C33H34F3N3O3 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 1-benzoyl-N-[4-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]butyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H34F3N3O3/c34-33(35,36)22-38-31(42)32(27-14-6-4-12-25(27)26-13-5-7-15-28(26)32)18-8-9-19-37-29(40)23-16-20-39(21-17-23)30(41)24-10-2-1-3-11-24/h1-7,10-15,23H,8-9,16-22H2,(H,37,40)(H,38,42) |
| InChIKey | HGQAWOBJNKYSMX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|