C27H56O4Si2 — CID 102103349
1,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyltetradecane-4,7-dione (PubChem CID 102103349) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is 1,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyltetradecane-4,7-dione.
| Compound Name | 1,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyltetradecane-4,7-dione |
|---|---|
| PubChem CID | 102103349 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | 1,10-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyltetradecane-4,7-dione |
| SMILES | CCCCC(O[Si](C)(C)C(C)(C)C)C(C)CC(=O)CCC(=O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O4Si2/c1-13-14-17-25(31-33(11,12)27(6,7)8)22(2)21-24(29)19-18-23(28)16-15-20-30-32(9,10)26(3,4)5/h22,25H,13-21H2,1-12H3 |
| InChIKey | QHVAWRBRNPKRLF-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|