C32H68O4Si2 — CID 23727962
(3R,7R,11R,15R)-1,16-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-3,7,11,15-tetramethylhexadecan-4-one (PubChem CID 23727962) has the molecular formula C32H68O4Si2 and a molecular weight of 573.06 g/mol. Its IUPAC name is (3R,7R,11R,15R)-1,16-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-3,7,11,15-tetramethylhexadecan-4-one.
| Compound Name | (3R,7R,11R,15R)-1,16-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-3,7,11,15-tetramethylhexadecan-4-one |
|---|---|
| PubChem CID | 23727962 |
| Molecular Formula | C32H68O4Si2 |
| Molecular Weight | 573.06 g/mol |
| Exact Mass | 572.47 |
| IUPAC Name | (3R,7R,11R,15R)-1,16-bis[[tert-butyl(dimethyl)silyl]oxy]-11-hydroxy-3,7,11,15-tetramethylhexadecan-4-one |
| SMILES | C[C@H](CCC[C@@](C)(O)CCC[C@@H](C)CO[Si](C)(C)C(C)(C)C)CCC(=O)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H68O4Si2/c1-26(19-20-29(33)28(3)21-24-35-37(11,12)30(4,5)6)17-15-22-32(10,34)23-16-18-27(2)25-36-38(13,14)31(7,8)9/h26-28,34H,15-25H2,1-14H3/t26-,27-,28-,32-/m1/s1 |
| InChIKey | BXWUSYDTBXMFBN-RBUURGHLSA-N |
| XLogP | 9.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.06 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|