C26H56O4Si2 — CID 50916380
(7S,8R,10S,11S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-7,11-dimethyldodecan-2-one (PubChem CID 50916380) has the molecular formula C26H56O4Si2 and a molecular weight of 488.90 g/mol. Its IUPAC name is (7S,8R,10S,11S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-7,11-dimethyldodecan-2-one.
| Compound Name | (7S,8R,10S,11S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-7,11-dimethyldodecan-2-one |
|---|---|
| PubChem CID | 50916380 |
| Molecular Formula | C26H56O4Si2 |
| Molecular Weight | 488.90 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | (7S,8R,10S,11S)-10,12-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-7,11-dimethyldodecan-2-one |
| SMILES | CC(=O)CCCC[C@H](C)[C@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H56O4Si2/c1-20(16-14-15-17-22(3)27)23(28)18-24(30-32(12,13)26(7,8)9)21(2)19-29-31(10,11)25(4,5)6/h20-21,23-24,28H,14-19H2,1-13H3/t20-,21-,23+,24-/m0/s1 |
| InChIKey | MLXNVOANFFTCBL-ZQRMPTRQSA-N |
| XLogP | 7.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.90 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|