C22H48O4Si2 — CID 71764106
(8R,9S,10R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,10-dimethyl-9-trimethylsilyloxyundecan-5-one (PubChem CID 71764106) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is (8R,9S,10R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,10-dimethyl-9-trimethylsilyloxyundecan-5-one.
| Compound Name | (8R,9S,10R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,10-dimethyl-9-trimethylsilyloxyundecan-5-one |
|---|---|
| PubChem CID | 71764106 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (8R,9S,10R)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-8,10-dimethyl-9-trimethylsilyloxyundecan-5-one |
| SMILES | C[C@H](CCC(=O)CCCCO)[C@H](O[Si](C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O4Si2/c1-18(14-15-20(24)13-11-12-16-23)21(26-27(6,7)8)19(2)17-25-28(9,10)22(3,4)5/h18-19,21,23H,11-17H2,1-10H3/t18-,19-,21+/m1/s1 |
| InChIKey | MXOICRWHEFKFQK-SBHAEUEKSA-N |
| XLogP | 6.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|