C33H70O5Si2 — CID 10746190
(2S,5S,6R,12S,13S,14R)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-1,17-dihydroxy-2,6,12,14-tetramethylheptadecan-9-one (PubChem CID 10746190) has the molecular formula C33H70O5Si2 and a molecular weight of 603.09 g/mol. Its IUPAC name is (2S,5S,6R,12S,13S,14R)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-1,17-dihydroxy-2,6,12,14-tetramethylheptadecan-9-one.
| Compound Name | (2S,5S,6R,12S,13S,14R)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-1,17-dihydroxy-2,6,12,14-tetramethylheptadecan-9-one |
|---|---|
| PubChem CID | 10746190 |
| Molecular Formula | C33H70O5Si2 |
| Molecular Weight | 603.09 g/mol |
| Exact Mass | 602.48 |
| IUPAC Name | (2S,5S,6R,12S,13S,14R)-5,13-bis[[tert-butyl(dimethyl)silyl]oxy]-1,17-dihydroxy-2,6,12,14-tetramethylheptadecan-9-one |
| SMILES | C[C@H](CO)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CCC(=O)CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CCCO |
| InChI | InChI=1S/C33H70O5Si2/c1-25(24-35)17-22-30(37-39(11,12)32(5,6)7)26(2)18-20-29(36)21-19-28(4)31(27(3)16-15-23-34)38-40(13,14)33(8,9)10/h25-28,30-31,34-35H,15-24H2,1-14H3/t25-,26+,27+,28-,30-,31-/m0/s1 |
| InChIKey | VUDZOZJUCFCDHS-KUGJVLABSA-N |
| XLogP | 8.99 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.09 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|