C21H44O4Si — CID 23256732
4-butyl-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]-4-hydroxyoctan-2-one (PubChem CID 23256732) has the molecular formula C21H44O4Si and a molecular weight of 388.67 g/mol. Its IUPAC name is 4-butyl-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]-4-hydroxyoctan-2-one.
| Compound Name | 4-butyl-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]-4-hydroxyoctan-2-one |
|---|---|
| PubChem CID | 23256732 |
| Molecular Formula | C21H44O4Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 4-butyl-3-[1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]-4-hydroxyoctan-2-one |
| SMILES | CCCCC(O)(CCCC)C(C(C)=O)C(CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O4Si/c1-9-11-13-21(24,14-12-10-2)19(17(3)23)18(15-22)16-25-26(7,8)20(4,5)6/h18-19,22,24H,9-16H2,1-8H3 |
| InChIKey | HIZXXTNSMAGNQH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|