C64H108O8 — CID 102103950
2,3,6,7-tetrakis-decoxy-1,5-bis(3-methylbutoxy)anthracene-9,10-dione (PubChem CID 102103950) has the molecular formula C64H108O8 and a molecular weight of 1005.56 g/mol. Its IUPAC name is 2,3,6,7-tetrakis-decoxy-1,5-bis(3-methylbutoxy)anthracene-9,10-dione.
| Compound Name | 2,3,6,7-tetrakis-decoxy-1,5-bis(3-methylbutoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 102103950 |
| Molecular Formula | C64H108O8 |
| Molecular Weight | 1005.56 g/mol |
| Exact Mass | 1004.80 |
| IUPAC Name | 2,3,6,7-tetrakis-decoxy-1,5-bis(3-methylbutoxy)anthracene-9,10-dione |
| SMILES | CCCCCCCCCCOc1cc2c(c(OCCC(C)C)c1OCCCCCCCCCC)C(=O)c1cc(OCCCCCCCCCC)c(OCCCCCCCCCC)c(OCCC(C)C)c1C2=O |
| InChI | InChI=1S/C64H108O8/c1-9-13-17-21-25-29-33-37-43-67-55-49-53-57(63(71-47-41-51(5)6)61(55)69-45-39-35-31-27-23-19-15-11-3)60(66)54-50-56(68-44-38-34-30-26-22-18-14-10-2)62(70-46-40-36-32-28-24-20-16-12-4)64(58(54)59(53)65)72-48-42-52(7)8/h49-52H,9-48H2,1-8H3 |
| InChIKey | PXWFFKPZDUBHFI-UHFFFAOYSA-N |
| XLogP | 19.39 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.56 |
| LogP ≤ 5 | 19.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|