C47H65NO10 — CID 102016366
1-hexoxy-5-[(4-nitrophenyl)methoxy]-2,3,6,7-tetrapentoxyanthracene-9,10-dione (PubChem CID 102016366) has the molecular formula C47H65NO10 and a molecular weight of 804.03 g/mol. Its IUPAC name is 1-hexoxy-5-[(4-nitrophenyl)methoxy]-2,3,6,7-tetrapentoxyanthracene-9,10-dione.
| Compound Name | 1-hexoxy-5-[(4-nitrophenyl)methoxy]-2,3,6,7-tetrapentoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 102016366 |
| Molecular Formula | C47H65NO10 |
| Molecular Weight | 804.03 g/mol |
| Exact Mass | 803.46 |
| IUPAC Name | 1-hexoxy-5-[(4-nitrophenyl)methoxy]-2,3,6,7-tetrapentoxyanthracene-9,10-dione |
| SMILES | CCCCCCOc1c(OCCCCC)c(OCCCCC)cc2c1C(=O)c1cc(OCCCCC)c(OCCCCC)c(OCc3ccc([N+](=O)[O-])cc3)c1C2=O |
| InChI | InChI=1S/C47H65NO10/c1-6-11-16-21-30-57-46-40-36(31-38(53-26-17-12-7-2)44(46)55-28-19-14-9-4)43(50)41-37(42(40)49)32-39(54-27-18-13-8-3)45(56-29-20-15-10-5)47(41)58-33-34-22-24-35(25-23-34)48(51)52/h22-25,31-32H,6-21,26-30,33H2,1-5H3 |
| InChIKey | CKCYWPPMOWAUFT-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.03 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|