C15H27NOSi — CID 102104524
trimethyl-[5-[[(2S)-2,4,4-trimethylpyrrolidin-2-yl]methyl]furan-2-yl]silane (PubChem CID 102104524) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is trimethyl-[5-[[(2S)-2,4,4-trimethylpyrrolidin-2-yl]methyl]furan-2-yl]silane.
| Compound Name | trimethyl-[5-[[(2S)-2,4,4-trimethylpyrrolidin-2-yl]methyl]furan-2-yl]silane |
|---|---|
| PubChem CID | 102104524 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | trimethyl-[5-[[(2S)-2,4,4-trimethylpyrrolidin-2-yl]methyl]furan-2-yl]silane |
| SMILES | CC1(C)CN[C@](C)(Cc2ccc([Si](C)(C)C)o2)C1 |
| InChI | InChI=1S/C15H27NOSi/c1-14(2)10-15(3,16-11-14)9-12-7-8-13(17-12)18(4,5)6/h7-8,16H,9-11H2,1-6H3/t15-/m1/s1 |
| InChIKey | PUUWGJOYCNLYRG-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|