C14H25NOSi — CID 102104526
[5-[(4,4-dimethylpyrrolidin-2-yl)methyl]furan-2-yl]-trimethylsilane (PubChem CID 102104526) has the molecular formula C14H25NOSi and a molecular weight of 251.45 g/mol. Its IUPAC name is [5-[(4,4-dimethylpyrrolidin-2-yl)methyl]furan-2-yl]-trimethylsilane.
| Compound Name | [5-[(4,4-dimethylpyrrolidin-2-yl)methyl]furan-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102104526 |
| Molecular Formula | C14H25NOSi |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | [5-[(4,4-dimethylpyrrolidin-2-yl)methyl]furan-2-yl]-trimethylsilane |
| SMILES | CC1(C)CNC(Cc2ccc([Si](C)(C)C)o2)C1 |
| InChI | InChI=1S/C14H25NOSi/c1-14(2)9-11(15-10-14)8-12-6-7-13(16-12)17(3,4)5/h6-7,11,15H,8-10H2,1-5H3 |
| InChIKey | RXFDTLNIMSQIJY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|