About methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate
methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate (PubChem CID 102105474) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate.
Analyze methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate?
The IUPAC name of methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate (CID 102105474) is methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate.
What is the SMILES notation for methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate?
The canonical SMILES for methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate is COC(=O)C1CC2CCC13CCC(=O)C=C3C2=O.
What is the InChIKey of methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate?
The InChIKey is MJGFNGPXPOCDJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4/c1-18-13(17)11-6-8-2-4-14(11)5-3-9(15)7-10(14)12(8)16/h7-8,11H,2-6H2,1H3.
What are the key properties of methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate?
methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate has a molecular weight of 248.28 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4,7-dioxotricyclo[6.2.2.01,6]dodec-5-ene-10-carboxylate is sourced from PubChem (CID 102105474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).