C22H26O2 — CID 102106176
2,2-dimethyl-1-phenylmethoxy-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[g]azulen-5-one (PubChem CID 102106176) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2,2-dimethyl-1-phenylmethoxy-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[g]azulen-5-one.
| Compound Name | 2,2-dimethyl-1-phenylmethoxy-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[g]azulen-5-one |
|---|---|
| PubChem CID | 102106176 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2,2-dimethyl-1-phenylmethoxy-3,3a,4,6,7,8-hexahydro-1H-cyclopenta[g]azulen-5-one |
| SMILES | CC1(C)CC2CC(=O)C3=C(C=C2C1OCc1ccccc1)CCC3 |
| InChI | InChI=1S/C22H26O2/c1-22(2)13-17-12-20(23)18-10-6-9-16(18)11-19(17)21(22)24-14-15-7-4-3-5-8-15/h3-5,7-8,11,17,21H,6,9-10,12-14H2,1-2H3 |
| InChIKey | YSNIBODXZGYHDL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |