C27H21O2PS — CID 102107293
methyl 1,4-diphenyl-1-thiophen-2-ylphosphinoline-2-carboxylate (PubChem CID 102107293) has the molecular formula C27H21O2PS and a molecular weight of 440.50 g/mol. Its IUPAC name is methyl 1,4-diphenyl-1-thiophen-2-ylphosphinoline-2-carboxylate.
| Compound Name | methyl 1,4-diphenyl-1-thiophen-2-ylphosphinoline-2-carboxylate |
|---|---|
| PubChem CID | 102107293 |
| Molecular Formula | C27H21O2PS |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | methyl 1,4-diphenyl-1-thiophen-2-ylphosphinoline-2-carboxylate |
| SMILES | COC(=O)C1=P(c2ccccc2)(c2cccs2)c2ccccc2C(c2ccccc2)=C1 |
| InChI | InChI=1S/C27H21O2PS/c1-29-27(28)25-19-23(20-11-4-2-5-12-20)22-15-8-9-16-24(22)30(25,26-17-10-18-31-26)21-13-6-3-7-14-21/h2-19H,1H3 |
| InChIKey | RQZCJKPFRSQOLJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|