C30H25O3P — CID 172879360
methyl 4-(3-methoxyphenyl)-1,1-diphenylphosphinoline-2-carboxylate (PubChem CID 172879360) has the molecular formula C30H25O3P and a molecular weight of 464.50 g/mol. Its IUPAC name is methyl 4-(3-methoxyphenyl)-1,1-diphenylphosphinoline-2-carboxylate.
| Compound Name | methyl 4-(3-methoxyphenyl)-1,1-diphenylphosphinoline-2-carboxylate |
|---|---|
| PubChem CID | 172879360 |
| Molecular Formula | C30H25O3P |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl 4-(3-methoxyphenyl)-1,1-diphenylphosphinoline-2-carboxylate |
| SMILES | COC(=O)C1=P(c2ccccc2)(c2ccccc2)c2ccccc2C(c2cccc(OC)c2)=C1 |
| InChI | InChI=1S/C30H25O3P/c1-32-23-13-11-12-22(20-23)27-21-29(30(31)33-2)34(24-14-5-3-6-15-24,25-16-7-4-8-17-25)28-19-10-9-18-26(27)28/h3-21H,1-2H3 |
| InChIKey | COWPWOHBBIECCM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|