C34H38O10 — CID 102107759
9-hydroxy-7-(9-hydroxy-1,3,4-trimethoxy-8-oxo-6,7,10,10a-tetrahydro-5H-anthracen-2-yl)-5,6,8-trimethoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one (PubChem CID 102107759) has the molecular formula C34H38O10 and a molecular weight of 606.67 g/mol. Its IUPAC name is 9-hydroxy-7-(9-hydroxy-1,3,4-trimethoxy-8-oxo-6,7,10,10a-tetrahydro-5H-anthracen-2-yl)-5,6,8-trimethoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one.
| Compound Name | 9-hydroxy-7-(9-hydroxy-1,3,4-trimethoxy-8-oxo-6,7,10,10a-tetrahydro-5H-anthracen-2-yl)-5,6,8-trimethoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one |
|---|---|
| PubChem CID | 102107759 |
| Molecular Formula | C34H38O10 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | 9-hydroxy-7-(9-hydroxy-1,3,4-trimethoxy-8-oxo-6,7,10,10a-tetrahydro-5H-anthracen-2-yl)-5,6,8-trimethoxy-3,4,4a,10-tetrahydro-2H-anthracen-1-one |
| SMILES | COc1c2c(c(OC)c(-c3c(OC)c(OC)c4c(c3OC)C(O)=C3C(=O)CCCC3C4)c1OC)C(O)=C1C(=O)CCCC1C2 |
| InChI | InChI=1S/C34H38O10/c1-39-29-17-13-15-9-7-11-19(35)21(15)27(37)23(17)31(41-3)25(33(29)43-5)26-32(42-4)24-18(30(40-2)34(26)44-6)14-16-10-8-12-20(36)22(16)28(24)38/h15-16,37-38H,7-14H2,1-6H3 |
| InChIKey | ACSYVBFQCRBWBR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |