C25H28N4O7 — CID 153449107
(9S,10R,12R)-9-amino-2,8,25-trihydroxy-15-methoxy-4,6-dioxo-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),2,7,15,24-pentaene-7-carboxamide (PubChem CID 153449107) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is (9S,10R,12R)-9-amino-2,8,25-trihydroxy-15-methoxy-4,6-dioxo-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),2,7,15,24-pentaene-7-carboxamide.
| Compound Name | (9S,10R,12R)-9-amino-2,8,25-trihydroxy-15-methoxy-4,6-dioxo-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),2,7,15,24-pentaene-7-carboxamide |
|---|---|
| PubChem CID | 153449107 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (9S,10R,12R)-9-amino-2,8,25-trihydroxy-15-methoxy-4,6-dioxo-18,23-diazahexacyclo[12.11.0.03,12.05,10.016,24.017,21]pentacosa-1(14),2,7,15,24-pentaene-7-carboxamide |
| SMILES | COc1c2c(c(O)c3c1C1NCCC1CN3)C(O)=C1C(=O)C3C(=O)C(C(N)=O)=C(O)[C@@H](N)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C25H28N4O7/c1-36-24-10-5-8-4-9-12(21(32)15(25(27)35)22(33)16(9)26)19(30)11(8)20(31)13(10)23(34)18-14(24)17-7(6-29-18)2-3-28-17/h7-9,12,16-17,28-29,31,33-34H,2-6,26H2,1H3,(H2,27,35)/t7?,8-,9-,12?,16+,17?/m1/s1 |
| InChIKey | KCSLLDPTBNDLRT-MCYMGNKKSA-N |
| XLogP | 0.33 |
| TPSA | 197.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|