C27H34N2O6 — CID 158516644
4-(dimethylamino)-3,10,11-trihydroxy-7-(4-methylpentyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 158516644) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 4-(dimethylamino)-3,10,11-trihydroxy-7-(4-methylpentyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-3,10,11-trihydroxy-7-(4-methylpentyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 158516644 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 4-(dimethylamino)-3,10,11-trihydroxy-7-(4-methylpentyl)-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)CCCc1ccc(O)c2c1CC1CC3C(C(=O)C(C(N)=O)=C(O)C3N(C)C)C(=O)C1=C2O |
| InChI | InChI=1S/C27H34N2O6/c1-12(2)6-5-7-13-8-9-17(30)19-15(13)10-14-11-16-20(24(32)18(14)23(19)31)25(33)21(27(28)35)26(34)22(16)29(3)4/h8-9,12,14,16,20,22,30-31,34H,5-7,10-11H2,1-4H3,(H2,28,35) |
| InChIKey | WDZRBDWTYPTINJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|