C27H31F2N3O6 — CID 162556992
9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 162556992) has the molecular formula C27H31F2N3O6 and a molecular weight of 531.56 g/mol. Its IUPAC name is 9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 162556992 |
| Molecular Formula | C27H31F2N3O6 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 9-[(4,4-difluoropiperidin-1-yl)methyl]-4-(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(O)=C(C(N)=O)C(=O)C2C(=O)C3=C(O)c4c(ccc(CN5CCC(F)(F)CC5)c4O)CC3CC21 |
| InChI | InChI=1S/C27H31F2N3O6/c1-31(2)20-15-10-14-9-12-3-4-13(11-32-7-5-27(28,29)6-8-32)21(33)16(12)22(34)17(14)23(35)18(15)24(36)19(25(20)37)26(30)38/h3-4,14-15,18,20,33-34,37H,5-11H2,1-2H3,(H2,30,38) |
| InChIKey | JMMHCYWXQKVDAW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|