C24H27N3O8 — CID 77469106
9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracene-2-carboxylic acid (PubChem CID 77469106) has the molecular formula C24H27N3O8 and a molecular weight of 485.49 g/mol. Its IUPAC name is 9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracene-2-carboxylic acid.
| Compound Name | 9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 77469106 |
| Molecular Formula | C24H27N3O8 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracene-2-carboxylic acid |
| SMILES | CN(C)c1cc(C(=O)O)c(O)c2c1CC1CC3C(C(=O)C(C(N)=O)=C(O)C3N(C)C)C(=O)C1=C2O |
| InChI | InChI=1S/C24H27N3O8/c1-26(2)12-7-11(24(34)35)18(28)14-9(12)5-8-6-10-15(20(30)13(8)19(14)29)21(31)16(23(25)33)22(32)17(10)27(3)4/h7-8,10,15,17,28-29,32H,5-6H2,1-4H3,(H2,25,33)(H,34,35) |
| InChIKey | JAVRRQCCVZNBEI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|