C30H32N4O7S — CID 88960466
S-phenyl N-[(7S)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamothioate (PubChem CID 88960466) has the molecular formula C30H32N4O7S and a molecular weight of 592.67 g/mol. Its IUPAC name is S-phenyl N-[(7S)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamothioate.
| Compound Name | S-phenyl N-[(7S)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamothioate |
|---|---|
| PubChem CID | 88960466 |
| Molecular Formula | C30H32N4O7S |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | S-phenyl N-[(7S)-9-carbamoyl-4,7-bis(dimethylamino)-1,8,12-trihydroxy-10,11-dioxo-5,5a,6,6a,7,10a-hexahydrotetracen-2-yl]carbamothioate |
| SMILES | CN(C)c1cc(NC(=O)Sc2ccccc2)c(O)c2c1CC1CC3C(C(=O)C(C(N)=O)=C(O)[C@H]3N(C)C)C(=O)C1=C2O |
| InChI | InChI=1S/C30H32N4O7S/c1-33(2)18-12-17(32-30(41)42-14-8-6-5-7-9-14)24(35)20-15(18)10-13-11-16-21(26(37)19(13)25(20)36)27(38)22(29(31)40)28(39)23(16)34(3)4/h5-9,12-13,16,21,23,35-36,39H,10-11H2,1-4H3,(H2,31,40)(H,32,41)/t13?,16?,21?,23-/m0/s1 |
| InChIKey | CVXGWYFKKVSKCO-DSMPKCFASA-N |
| XLogP | 3.24 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|