C28H26N4O7S — CID 138512199
S-phenyl N-[(5aR)-9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-6-imino-8,11-dioxo-5a,6a,7,10a-tetrahydro-5H-tetracen-2-yl]carbamothioate (PubChem CID 138512199) has the molecular formula C28H26N4O7S and a molecular weight of 562.60 g/mol. Its IUPAC name is S-phenyl N-[(5aR)-9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-6-imino-8,11-dioxo-5a,6a,7,10a-tetrahydro-5H-tetracen-2-yl]carbamothioate.
| Compound Name | S-phenyl N-[(5aR)-9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-6-imino-8,11-dioxo-5a,6a,7,10a-tetrahydro-5H-tetracen-2-yl]carbamothioate |
|---|---|
| PubChem CID | 138512199 |
| Molecular Formula | C28H26N4O7S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | S-phenyl N-[(5aR)-9-carbamoyl-4-(dimethylamino)-1,10,12-trihydroxy-6-imino-8,11-dioxo-5a,6a,7,10a-tetrahydro-5H-tetracen-2-yl]carbamothioate |
| SMILES | [H]/N=C1\C2CC(=O)C(C(N)=O)=C(O)C2C(=O)C2=C(O)c3c(O)c(NC(=O)Sc4ccccc4)cc(N(C)C)c3C[C@H]21 |
| InChI | InChI=1S/C28H26N4O7S/c1-32(2)16-10-15(31-28(39)40-11-6-4-3-5-7-11)23(34)18-12(16)8-13-19(24(18)35)25(36)20-14(22(13)29)9-17(33)21(26(20)37)27(30)38/h3-7,10,13-14,20,29,34-35,37H,8-9H2,1-2H3,(H2,30,38)(H,31,39)/b29-22-/t13-,14?,20?/m1/s1 |
| InChIKey | MIOIAARXMVQKRH-ARGYIVAZSA-N |
| XLogP | 3.33 |
| TPSA | 194.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|