C28H28N4O8 — CID 138512096
(12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(phenylcarbamoylamino)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 138512096) has the molecular formula C28H28N4O8 and a molecular weight of 548.55 g/mol. Its IUPAC name is (12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(phenylcarbamoylamino)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(phenylcarbamoylamino)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 138512096 |
| Molecular Formula | C28H28N4O8 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | (12aR)-7-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(phenylcarbamoylamino)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)Nc2ccccc2)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H28N4O8/c1-32(2)17-11-16(31-27(39)30-14-6-4-3-5-7-14)22(34)20-15(17)9-12-8-13-10-18(33)21(26(29)38)25(37)28(13,40)24(36)19(12)23(20)35/h3-7,11-13,34-35,37,40H,8-10H2,1-2H3,(H2,29,38)(H2,30,31,39)/t12?,13?,28-/m0/s1 |
| InChIKey | JTMMMJPYQBNPME-LHUKGHGOSA-N |
| XLogP | 2.13 |
| TPSA | 202.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|