C23H24N2O9 — CID 54741947
methyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate (PubChem CID 54741947) has the molecular formula C23H24N2O9 and a molecular weight of 472.45 g/mol. Its IUPAC name is methyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate.
| Compound Name | methyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate |
|---|---|
| PubChem CID | 54741947 |
| Molecular Formula | C23H24N2O9 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | methyl (5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carboxylate |
| SMILES | COC(=O)c1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C23H24N2O9/c1-25(2)12-7-11(22(32)34-3)17(27)15-10(12)5-8-4-9-6-13(26)16(21(24)31)20(30)23(9,33)19(29)14(8)18(15)28/h7-9,27-28,30,33H,4-6H2,1-3H3,(H2,24,31)/t8-,9+,23+/m1/s1 |
| InChIKey | XBISZDAVGCJCQV-OIFKANJSSA-N |
| XLogP | 0.28 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|