C27H32N2O10 — CID 160712796
2-methoxyethyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate (PubChem CID 160712796) has the molecular formula C27H32N2O10 and a molecular weight of 544.56 g/mol. Its IUPAC name is 2-methoxyethyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate.
| Compound Name | 2-methoxyethyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
|---|---|
| PubChem CID | 160712796 |
| Molecular Formula | C27H32N2O10 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 2-methoxyethyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
| SMILES | COCCOC(=O)CCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C27H32N2O10/c1-29(2)16-10-12(4-5-18(31)39-7-6-38-3)22(32)20-15(16)9-13-8-14-11-17(30)21(26(28)36)25(35)27(14,37)24(34)19(13)23(20)33/h10,13-14,32-33,35,37H,4-9,11H2,1-3H3,(H2,28,36)/t13-,14+,27+/m1/s1 |
| InChIKey | RRVXCNZEOOMELS-VXKZXEGRSA-N |
| XLogP | 0.61 |
| TPSA | 196.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|