C26H29Cl2N3O9 — CID 58647460
2,2-dichloropropyl N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate (PubChem CID 58647460) has the molecular formula C26H29Cl2N3O9 and a molecular weight of 598.44 g/mol. Its IUPAC name is 2,2-dichloropropyl N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate.
| Compound Name | 2,2-dichloropropyl N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58647460 |
| Molecular Formula | C26H29Cl2N3O9 |
| Molecular Weight | 598.44 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | 2,2-dichloropropyl N-[[(5aR,6aS,10aR)-9-carbamoyl-4-(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
| SMILES | CN(C)c1cc(CNC(=O)OCC(C)(Cl)Cl)c(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C26H29Cl2N3O9/c1-25(27,28)9-40-24(38)30-8-11-6-14(31(2)3)13-5-10-4-12-7-15(32)18(23(29)37)22(36)26(12,39)21(35)16(10)20(34)17(13)19(11)33/h6,10,12,33-34,36,39H,4-5,7-9H2,1-3H3,(H2,29,37)(H,30,38)/t10-,12+,26+/m1/s1 |
| InChIKey | IOYLABUOJXMITP-YYQJGWKRSA-N |
| XLogP | 1.91 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|