C27H31Cl3N4O9 — CID 54678712
2,2,2-trichloroethyl N-[[(7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate (PubChem CID 54678712) has the molecular formula C27H31Cl3N4O9 and a molecular weight of 661.92 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[[(7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[[(7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 54678712 |
| Molecular Formula | C27H31Cl3N4O9 |
| Molecular Weight | 661.92 g/mol |
| Exact Mass | 660.12 |
| IUPAC Name | 2,2,2-trichloroethyl N-[[(7R,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
| SMILES | CN(C)c1cc(CNC(=O)OCC(Cl)(Cl)Cl)c(O)c2c1CC1CC3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H31Cl3N4O9/c1-33(2)14-7-11(8-32-25(41)43-9-26(28,29)30)19(35)16-12(14)5-10-6-13-18(34(3)4)21(37)17(24(31)40)23(39)27(13,42)22(38)15(10)20(16)36/h7,10,13,18,35-36,39,42H,5-6,8-9H2,1-4H3,(H2,31,40)(H,32,41)/t10?,13?,18-,27+/m1/s1 |
| InChIKey | HSPRMBQQNSKPPP-UAAQFVHBSA-N |
| XLogP | 1.63 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.92 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|