C31H40N4O8 — CID 72653992
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[(2-methylcyclopentanecarbonyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 72653992) has the molecular formula C31H40N4O8 and a molecular weight of 596.68 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[(2-methylcyclopentanecarbonyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[(2-methylcyclopentanecarbonyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 72653992 |
| Molecular Formula | C31H40N4O8 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[(2-methylcyclopentanecarbonyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1CCCC1C(=O)NCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C31H40N4O8/c1-13-7-6-8-16(13)30(42)33-12-15-11-19(34(2)3)17-9-14-10-18-23(35(4)5)26(38)22(29(32)41)28(40)31(18,43)27(39)20(14)25(37)21(17)24(15)36/h11,13-14,16,18,23,36-37,40,43H,6-10,12H2,1-5H3,(H2,32,41)(H,33,42) |
| InChIKey | NVLDPMNZPWXZOH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|