C29H36N4O9 — CID 54713442
2-methylprop-2-enyl N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate (PubChem CID 54713442) has the molecular formula C29H36N4O9 and a molecular weight of 584.63 g/mol. Its IUPAC name is 2-methylprop-2-enyl N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate.
| Compound Name | 2-methylprop-2-enyl N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 54713442 |
| Molecular Formula | C29H36N4O9 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 2-methylprop-2-enyl N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
| SMILES | C=C(C)COC(=O)NCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C29H36N4O9/c1-12(2)11-42-28(40)31-10-14-9-17(32(3)4)15-7-13-8-16-21(33(5)6)24(36)20(27(30)39)26(38)29(16,41)25(37)18(13)23(35)19(15)22(14)34/h9,13,16,21,34-35,38,41H,1,7-8,10-11H2,2-6H3,(H2,30,39)(H,31,40) |
| InChIKey | VFTYKBDAWSQTRQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|