C31H33BrN4O9 — CID 54681096
(4-bromophenyl) N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate (PubChem CID 54681096) has the molecular formula C31H33BrN4O9 and a molecular weight of 685.53 g/mol. Its IUPAC name is (4-bromophenyl) N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate.
| Compound Name | (4-bromophenyl) N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 54681096 |
| Molecular Formula | C31H33BrN4O9 |
| Molecular Weight | 685.53 g/mol |
| Exact Mass | 684.14 |
| IUPAC Name | (4-bromophenyl) N-[[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
| SMILES | CN(C)c1cc(CNC(=O)Oc2ccc(Br)cc2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H33BrN4O9/c1-35(2)19-11-14(12-34-30(43)45-16-7-5-15(32)6-8-16)24(37)21-17(19)9-13-10-18-23(36(3)4)26(39)22(29(33)42)28(41)31(18,44)27(40)20(13)25(21)38/h5-8,11,13,18,23,37-38,41,44H,9-10,12H2,1-4H3,(H2,33,42)(H,34,43) |
| InChIKey | CHVIDBJYYYGRDL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 202.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|