C33H37N3O9 — CID 76793465
(4-methylphenyl) 3-[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate (PubChem CID 76793465) has the molecular formula C33H37N3O9 and a molecular weight of 619.67 g/mol. Its IUPAC name is (4-methylphenyl) 3-[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate.
| Compound Name | (4-methylphenyl) 3-[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
|---|---|
| PubChem CID | 76793465 |
| Molecular Formula | C33H37N3O9 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | (4-methylphenyl) 3-[9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
| SMILES | Cc1ccc(OC(=O)CCc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)C4(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C4CC2C3)cc1 |
| InChI | InChI=1S/C33H37N3O9/c1-15-6-9-18(10-7-15)45-22(37)11-8-16-14-21(35(2)3)19-12-17-13-20-26(36(4)5)29(40)25(32(34)43)31(42)33(20,44)30(41)23(17)28(39)24(19)27(16)38/h6-7,9-10,14,17,20,26,38-39,42,44H,8,11-13H2,1-5H3,(H2,34,43) |
| InChIKey | NAYUGLPRHWSQCR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|