C32H43N3O9 — CID 58461215
hexyl 3-[(5aS,6aR,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate (PubChem CID 58461215) has the molecular formula C32H43N3O9 and a molecular weight of 613.71 g/mol. Its IUPAC name is hexyl 3-[(5aS,6aR,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate.
| Compound Name | hexyl 3-[(5aS,6aR,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
|---|---|
| PubChem CID | 58461215 |
| Molecular Formula | C32H43N3O9 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | hexyl 3-[(5aS,6aR,7R,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
| SMILES | CCCCCCOC(=O)CCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@@]3(O)C(O)=C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]3C[C@H]1C2 |
| InChI | InChI=1S/C32H43N3O9/c1-6-7-8-9-12-44-21(36)11-10-16-15-20(34(2)3)18-13-17-14-19-25(35(4)5)28(39)24(31(33)42)30(41)32(19,43)29(40)22(17)27(38)23(18)26(16)37/h15,17,19,25,37-38,41,43H,6-14H2,1-5H3,(H2,33,42)/t17-,19-,25-,32-/m1/s1 |
| InChIKey | DLJAUGXRNAWFFW-NOMXJAAZSA-N |
| XLogP | 2.09 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|