C31H41N3O9 — CID 123660497
pentyl 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate (PubChem CID 123660497) has the molecular formula C31H41N3O9 and a molecular weight of 599.68 g/mol. Its IUPAC name is pentyl 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate.
| Compound Name | pentyl 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
|---|---|
| PubChem CID | 123660497 |
| Molecular Formula | C31H41N3O9 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | pentyl 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
| SMILES | CCCCCOC(=O)CCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C31H41N3O9/c1-6-7-8-11-43-20(35)10-9-15-14-19(33(2)3)17-12-16-13-18-24(34(4)5)27(38)23(30(32)41)29(40)31(18,42)28(39)21(16)26(37)22(17)25(15)36/h14,16,18,24,36-37,40,42H,6-13H2,1-5H3,(H2,32,41)/t16-,18-,24-,31-/m0/s1 |
| InChIKey | WHKCUQCRCIDEJR-ZAARVUNWSA-N |
| XLogP | 1.70 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|