C30H39N3O8 — CID 158960114
4,7-bis(dimethylamino)-9-(4,4-dimethyl-3-oxopentyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 158960114) has the molecular formula C30H39N3O8 and a molecular weight of 569.66 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-9-(4,4-dimethyl-3-oxopentyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-9-(4,4-dimethyl-3-oxopentyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 158960114 |
| Molecular Formula | C30H39N3O8 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 4,7-bis(dimethylamino)-9-(4,4-dimethyl-3-oxopentyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCC(=O)C(C)(C)C)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H39N3O8/c1-29(2,3)18(34)9-8-13-12-17(32(4)5)15-10-14-11-16-22(33(6)7)25(37)21(28(31)40)27(39)30(16,41)26(38)19(14)24(36)20(15)23(13)35/h12,14,16,22,35-36,39,41H,8-11H2,1-7H3,(H2,31,40) |
| InChIKey | XUFCSWDFGQZZBR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|