C28H37N3O9S — CID 76793469
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(4-methylsulfonylbutyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 76793469) has the molecular formula C28H37N3O9S and a molecular weight of 591.68 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(4-methylsulfonylbutyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(4-methylsulfonylbutyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 76793469 |
| Molecular Formula | C28H37N3O9S |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-(4-methylsulfonylbutyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCCCS(C)(=O)=O)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H37N3O9S/c1-30(2)17-12-13(8-6-7-9-41(5,39)40)22(32)19-15(17)10-14-11-16-21(31(3)4)24(34)20(27(29)37)26(36)28(16,38)25(35)18(14)23(19)33/h12,14,16,21,32-33,36,38H,6-11H2,1-5H3,(H2,29,37) |
| InChIKey | FVZWZTNIBOBTKT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 198.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|