C31H41N3O7S — CID 153022566
(4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(thian-4-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 153022566) has the molecular formula C31H41N3O7S and a molecular weight of 599.75 g/mol. Its IUPAC name is (4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(thian-4-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(thian-4-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 153022566 |
| Molecular Formula | C31H41N3O7S |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.27 |
| IUPAC Name | (4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[3-(thian-4-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCCC2CCSCC2)c(O)c2c1C[C@H]1C[C@H]3C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H41N3O7S/c1-33(2)20-14-16(7-5-6-15-8-10-42-11-9-15)25(35)22-18(20)12-17-13-19-24(34(3)4)27(37)23(30(32)40)29(39)31(19,41)28(38)21(17)26(22)36/h14-15,17,19,24,35-36,39,41H,5-13H2,1-4H3,(H2,32,40)/t17-,19-,24?,31-/m0/s1 |
| InChIKey | MBBGEZPSCFJQIK-AGNPFIICSA-N |
| XLogP | 2.50 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|