C29H35F2N3O7 — CID 159873361
(4S,4aS,5aR,12aR)-9-[2-(3,3-difluorocyclobutyl)ethyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 159873361) has the molecular formula C29H35F2N3O7 and a molecular weight of 575.61 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-[2-(3,3-difluorocyclobutyl)ethyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-[2-(3,3-difluorocyclobutyl)ethyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 159873361 |
| Molecular Formula | C29H35F2N3O7 |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[2-(3,3-difluorocyclobutyl)ethyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(CCC2CC(F)(F)C2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H35F2N3O7/c1-33(2)17-9-13(6-5-12-10-28(30,31)11-12)22(35)19-15(17)7-14-8-16-21(34(3)4)24(37)20(27(32)40)26(39)29(16,41)25(38)18(14)23(19)36/h9,12,14,16,21,35-36,39,41H,5-8,10-11H2,1-4H3,(H2,32,40)/t14-,16-,21-,29-/m0/s1 |
| InChIKey | BVXIWUGKLJDYGG-FDIAEVORSA-N |
| XLogP | 2.01 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|