C28H34F3N3O7 — CID 157116183
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(4,4,4-trifluoro-3-methylbutyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 157116183) has the molecular formula C28H34F3N3O7 and a molecular weight of 581.59 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(4,4,4-trifluoro-3-methylbutyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(4,4,4-trifluoro-3-methylbutyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 157116183 |
| Molecular Formula | C28H34F3N3O7 |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-(4,4,4-trifluoro-3-methylbutyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(CCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)C3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C3CC1C2)C(F)(F)F |
| InChI | InChI=1S/C28H34F3N3O7/c1-11(28(29,30)31)6-7-12-10-16(33(2)3)14-8-13-9-15-20(34(4)5)23(37)19(26(32)40)25(39)27(15,41)24(38)17(13)22(36)18(14)21(12)35/h10-11,13,15,20,35-36,39,41H,6-9H2,1-5H3,(H2,32,40) |
| InChIKey | AVFZAQNCTKRRES-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|