C30H37N3O9 — CID 58461497
but-3-enyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate (PubChem CID 58461497) has the molecular formula C30H37N3O9 and a molecular weight of 583.64 g/mol. Its IUPAC name is but-3-enyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate.
| Compound Name | but-3-enyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
|---|---|
| PubChem CID | 58461497 |
| Molecular Formula | C30H37N3O9 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | but-3-enyl 3-[(5aR,6aS,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
| SMILES | C=CCCOC(=O)CCc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C30H37N3O9/c1-6-7-10-42-19(34)9-8-14-13-18(32(2)3)16-11-15-12-17-23(33(4)5)26(37)22(29(31)40)28(39)30(17,41)27(38)20(15)25(36)21(16)24(14)35/h6,13,15,17,23,35-36,39,41H,1,7-12H2,2-5H3,(H2,31,40)/t15-,17-,23?,30-/m0/s1 |
| InChIKey | LKHWMOLNDFDGLA-VYKVAFRJSA-N |
| XLogP | 1.08 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|