C32H34FN3O9 — CID 58461489
(4-fluorophenyl) 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate (PubChem CID 58461489) has the molecular formula C32H34FN3O9 and a molecular weight of 623.63 g/mol. Its IUPAC name is (4-fluorophenyl) 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate.
| Compound Name | (4-fluorophenyl) 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
|---|---|
| PubChem CID | 58461489 |
| Molecular Formula | C32H34FN3O9 |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | (4-fluorophenyl) 3-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]propanoate |
| SMILES | CN(C)c1cc(CCC(=O)Oc2ccc(F)cc2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H34FN3O9/c1-35(2)20-13-14(5-10-21(37)45-17-8-6-16(33)7-9-17)26(38)23-18(20)11-15-12-19-25(36(3)4)28(40)24(31(34)43)30(42)32(19,44)29(41)22(15)27(23)39/h6-9,13,15,19,25,38-39,42,44H,5,10-12H2,1-4H3,(H2,34,43)/t15-,19-,25-,32-/m0/s1 |
| InChIKey | PSIKBHYULDRLKJ-XZJXKXEKSA-N |
| XLogP | 1.71 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|