C32H34ClN3O9 — CID 23572494
(4-chlorophenyl) N-[[9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate (PubChem CID 23572494) has the molecular formula C32H34ClN3O9 and a molecular weight of 640.09 g/mol. Its IUPAC name is (4-chlorophenyl) N-[[9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate.
| Compound Name | (4-chlorophenyl) N-[[9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 23572494 |
| Molecular Formula | C32H34ClN3O9 |
| Molecular Weight | 640.09 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | (4-chlorophenyl) N-[[9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]methyl]carbamate |
| SMILES | CC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(CNC(=O)Oc5ccc(Cl)cc5)cc(N(C)C)c4CC3CC2C(N(C)C)C1=O |
| InChI | InChI=1S/C32H34ClN3O9/c1-14(37)22-28(40)25(36(4)5)20-11-15-10-19-21(35(2)3)12-16(13-34-31(43)45-18-8-6-17(33)7-9-18)26(38)24(19)27(39)23(15)30(42)32(20,44)29(22)41/h6-9,12,15,20,25,38-39,41,44H,10-11,13H2,1-5H3,(H,34,43) |
| InChIKey | GZSCNWHAIBOBKN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 176.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|