C30H41N3O7 — CID 158302301
(4aR,11aR,12aS)-3-acetyl-1,10-bis(dimethylamino)-8-[(2,2-dimethylpropylamino)methyl]-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 158302301) has the molecular formula C30H41N3O7 and a molecular weight of 555.67 g/mol. Its IUPAC name is (4aR,11aR,12aS)-3-acetyl-1,10-bis(dimethylamino)-8-[(2,2-dimethylpropylamino)methyl]-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11aR,12aS)-3-acetyl-1,10-bis(dimethylamino)-8-[(2,2-dimethylpropylamino)methyl]-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 158302301 |
| Molecular Formula | C30H41N3O7 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | (4aR,11aR,12aS)-3-acetyl-1,10-bis(dimethylamino)-8-[(2,2-dimethylpropylamino)methyl]-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(CNCC(C)(C)C)cc(N(C)C)c4C[C@H]3C[C@H]2C(N(C)C)C1=O |
| InChI | InChI=1S/C30H41N3O7/c1-14(34)20-26(37)23(33(7)8)18-10-15-9-17-19(32(5)6)11-16(12-31-13-29(2,3)4)24(35)22(17)25(36)21(15)28(39)30(18,40)27(20)38/h11,15,18,23,31,35-36,38,40H,9-10,12-13H2,1-8H3/t15-,18-,23?,30+/m0/s1 |
| InChIKey | YAMHHEYKQNDUOS-FCHNLDNYSA-N |
| XLogP | 2.27 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|