C25H28N2O8 — CID 59518778
(5aR,6aS,10aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carbaldehyde (PubChem CID 59518778) has the molecular formula C25H28N2O8 and a molecular weight of 484.51 g/mol. Its IUPAC name is (5aR,6aS,10aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carbaldehyde.
| Compound Name | (5aR,6aS,10aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carbaldehyde |
|---|---|
| PubChem CID | 59518778 |
| Molecular Formula | C25H28N2O8 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (5aR,6aS,10aR)-9-acetyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracene-2-carbaldehyde |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(C=O)cc(N(C)C)c4C[C@H]3C[C@H]2C(N(C)C)C1=O |
| InChI | InChI=1S/C25H28N2O8/c1-10(29)16-22(32)19(27(4)5)14-7-11-6-13-15(26(2)3)8-12(9-28)20(30)18(13)21(31)17(11)24(34)25(14,35)23(16)33/h8-9,11,14,19,30-31,33,35H,6-7H2,1-5H3/t11-,14-,19?,25+/m0/s1 |
| InChIKey | MVXLCDFPFBDBQV-LVOQGNEBSA-N |
| XLogP | 0.95 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|