C25H27N3O7 — CID 118653294
(13R,15S,16S,20R)-18-acetyl-10,16-bis(dimethylamino)-2,19,20-trihydroxy-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-17,21-dione (PubChem CID 118653294) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is (13R,15S,16S,20R)-18-acetyl-10,16-bis(dimethylamino)-2,19,20-trihydroxy-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-17,21-dione.
| Compound Name | (13R,15S,16S,20R)-18-acetyl-10,16-bis(dimethylamino)-2,19,20-trihydroxy-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-17,21-dione |
|---|---|
| PubChem CID | 118653294 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (13R,15S,16S,20R)-18-acetyl-10,16-bis(dimethylamino)-2,19,20-trihydroxy-5-oxa-7-azapentacyclo[11.8.0.03,11.04,8.015,20]henicosa-1,3,6,8,10,18-hexaene-17,21-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(c(N(C)C)cc5ncoc45)C[C@H]3C[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C25H27N3O7/c1-10(29)16-21(31)19(28(4)5)13-7-11-6-12-15(27(2)3)8-14-22(35-9-26-14)18(12)20(30)17(11)24(33)25(13,34)23(16)32/h8-9,11,13,19,30,32,34H,6-7H2,1-5H3/t11-,13-,19-,25+/m0/s1 |
| InChIKey | TYCFCYIMWZZYEO-YJPSRWBZSA-N |
| XLogP | 1.57 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|